C16H20ClNO2 — CID 171212981
(1R)-1-(4-methoxy-3-phenylmethoxyphenyl)ethanamine;hydrochloride (PubChem CID 171212981) has the molecular formula C16H20ClNO2 and a molecular weight of 293.79 g/mol. Its IUPAC name is (1R)-1-(4-methoxy-3-phenylmethoxyphenyl)ethanamine;hydrochloride.
| Compound Name | (1R)-1-(4-methoxy-3-phenylmethoxyphenyl)ethanamine;hydrochloride |
|---|---|
| PubChem CID | 171212981 |
| Molecular Formula | C16H20ClNO2 |
| Molecular Weight | 293.79 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | (1R)-1-(4-methoxy-3-phenylmethoxyphenyl)ethanamine;hydrochloride |
| SMILES | COc1ccc([C@@H](C)N)cc1OCc1ccccc1.Cl |
| InChI | InChI=1S/C16H19NO2.ClH/c1-12(17)14-8-9-15(18-2)16(10-14)19-11-13-6-4-3-5-7-13;/h3-10,12H,11,17H2,1-2H3;1H/t12-;/m1./s1 |
| InChIKey | MOBUTOCLOHWBAR-UTONKHPSSA-N |
| XLogP | 3.72 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.79 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |