C19H20ClNO2S — CID 171213015
(S)-(4-methoxy-3-phenylmethoxyphenyl)-thiophen-3-ylmethanamine;hydrochloride (PubChem CID 171213015) has the molecular formula C19H20ClNO2S and a molecular weight of 361.89 g/mol. Its IUPAC name is (S)-(4-methoxy-3-phenylmethoxyphenyl)-thiophen-3-ylmethanamine;hydrochloride.
| Compound Name | (S)-(4-methoxy-3-phenylmethoxyphenyl)-thiophen-3-ylmethanamine;hydrochloride |
|---|---|
| PubChem CID | 171213015 |
| Molecular Formula | C19H20ClNO2S |
| Molecular Weight | 361.89 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | (S)-(4-methoxy-3-phenylmethoxyphenyl)-thiophen-3-ylmethanamine;hydrochloride |
| SMILES | COc1ccc([C@H](N)c2ccsc2)cc1OCc1ccccc1.Cl |
| InChI | InChI=1S/C19H19NO2S.ClH/c1-21-17-8-7-15(19(20)16-9-10-23-13-16)11-18(17)22-12-14-5-3-2-4-6-14;/h2-11,13,19H,12,20H2,1H3;1H/t19-;/m0./s1 |
| InChIKey | ODFYMINWICRQOM-FYZYNONXSA-N |
| XLogP | 4.81 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.89 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |