C12H14ClNO2S — CID 171199311
5-[(S)-amino(thiophen-3-yl)methyl]-2-methoxyphenol;hydrochloride (PubChem CID 171199311) has the molecular formula C12H14ClNO2S and a molecular weight of 271.77 g/mol. Its IUPAC name is 5-[(S)-amino(thiophen-3-yl)methyl]-2-methoxyphenol;hydrochloride.
| Compound Name | 5-[(S)-amino(thiophen-3-yl)methyl]-2-methoxyphenol;hydrochloride |
|---|---|
| PubChem CID | 171199311 |
| Molecular Formula | C12H14ClNO2S |
| Molecular Weight | 271.77 g/mol |
| Exact Mass | 271.04 |
| IUPAC Name | 5-[(S)-amino(thiophen-3-yl)methyl]-2-methoxyphenol;hydrochloride |
| SMILES | COc1ccc([C@H](N)c2ccsc2)cc1O.Cl |
| InChI | InChI=1S/C12H13NO2S.ClH/c1-15-11-3-2-8(6-10(11)14)12(13)9-4-5-16-7-9;/h2-7,12,14H,13H2,1H3;1H/t12-;/m0./s1 |
| InChIKey | YAKJGZFBPNQUSC-YDALLXLXSA-N |
| XLogP | 2.93 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.77 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |