C14H18ClNO3S — CID 171201055
(S)-thiophen-3-yl-(2,4,6-trimethoxyphenyl)methanamine;hydrochloride (PubChem CID 171201055) has the molecular formula C14H18ClNO3S and a molecular weight of 315.82 g/mol. Its IUPAC name is (S)-thiophen-3-yl-(2,4,6-trimethoxyphenyl)methanamine;hydrochloride.
| Compound Name | (S)-thiophen-3-yl-(2,4,6-trimethoxyphenyl)methanamine;hydrochloride |
|---|---|
| PubChem CID | 171201055 |
| Molecular Formula | C14H18ClNO3S |
| Molecular Weight | 315.82 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | (S)-thiophen-3-yl-(2,4,6-trimethoxyphenyl)methanamine;hydrochloride |
| SMILES | COc1cc(OC)c([C@H](N)c2ccsc2)c(OC)c1.Cl |
| InChI | InChI=1S/C14H17NO3S.ClH/c1-16-10-6-11(17-2)13(12(7-10)18-3)14(15)9-4-5-19-8-9;/h4-8,14H,15H2,1-3H3;1H/t14-;/m1./s1 |
| InChIKey | AGYMBJBEBSLUEI-PFEQFJNWSA-N |
| XLogP | 3.24 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.82 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |