C13H13ClF3NO2S — CID 171236225
(R)-[2-methoxy-4-(trifluoromethoxy)phenyl]-thiophen-3-ylmethanamine;hydrochloride (PubChem CID 171236225) has the molecular formula C13H13ClF3NO2S and a molecular weight of 339.77 g/mol. Its IUPAC name is (R)-[2-methoxy-4-(trifluoromethoxy)phenyl]-thiophen-3-ylmethanamine;hydrochloride.
| Compound Name | (R)-[2-methoxy-4-(trifluoromethoxy)phenyl]-thiophen-3-ylmethanamine;hydrochloride |
|---|---|
| PubChem CID | 171236225 |
| Molecular Formula | C13H13ClF3NO2S |
| Molecular Weight | 339.77 g/mol |
| Exact Mass | 339.03 |
| IUPAC Name | (R)-[2-methoxy-4-(trifluoromethoxy)phenyl]-thiophen-3-ylmethanamine;hydrochloride |
| SMILES | COc1cc(OC(F)(F)F)ccc1[C@@H](N)c1ccsc1.Cl |
| InChI | InChI=1S/C13H12F3NO2S.ClH/c1-18-11-6-9(19-13(14,15)16)2-3-10(11)12(17)8-4-5-20-7-8;/h2-7,12H,17H2,1H3;1H/t12-;/m0./s1 |
| InChIKey | AGPKKXYSPPWXJQ-YDALLXLXSA-N |
| XLogP | 4.13 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.77 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |