C12H10ClF4NOS — CID 171216256
(S)-[2-fluoro-5-(trifluoromethoxy)phenyl]-thiophen-3-ylmethanamine;hydrochloride (PubChem CID 171216256) has the molecular formula C12H10ClF4NOS and a molecular weight of 327.73 g/mol. Its IUPAC name is (S)-[2-fluoro-5-(trifluoromethoxy)phenyl]-thiophen-3-ylmethanamine;hydrochloride.
| Compound Name | (S)-[2-fluoro-5-(trifluoromethoxy)phenyl]-thiophen-3-ylmethanamine;hydrochloride |
|---|---|
| PubChem CID | 171216256 |
| Molecular Formula | C12H10ClF4NOS |
| Molecular Weight | 327.73 g/mol |
| Exact Mass | 327.01 |
| IUPAC Name | (S)-[2-fluoro-5-(trifluoromethoxy)phenyl]-thiophen-3-ylmethanamine;hydrochloride |
| SMILES | Cl.N[C@H](c1ccsc1)c1cc(OC(F)(F)F)ccc1F |
| InChI | InChI=1S/C12H9F4NOS.ClH/c13-10-2-1-8(18-12(14,15)16)5-9(10)11(17)7-3-4-19-6-7;/h1-6,11H,17H2;1H/t11-;/m1./s1 |
| InChIKey | QLDOQDQHOUJPHY-RFVHGSKJSA-N |
| XLogP | 4.26 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.73 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |