C12H13NO2S — CID 171220300
4-[(R)-amino(thiophen-3-yl)methyl]-3-methoxyphenol (PubChem CID 171220300) has the molecular formula C12H13NO2S and a molecular weight of 235.31 g/mol. Its IUPAC name is 4-[(R)-amino(thiophen-3-yl)methyl]-3-methoxyphenol.
| Compound Name | 4-[(R)-amino(thiophen-3-yl)methyl]-3-methoxyphenol |
|---|---|
| PubChem CID | 171220300 |
| Molecular Formula | C12H13NO2S |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.07 |
| IUPAC Name | 4-[(R)-amino(thiophen-3-yl)methyl]-3-methoxyphenol |
| SMILES | COc1cc(O)ccc1[C@@H](N)c1ccsc1 |
| InChI | InChI=1S/C12H13NO2S/c1-15-11-6-9(14)2-3-10(11)12(13)8-4-5-16-7-8/h2-7,12,14H,13H2,1H3/t12-/m0/s1 |
| InChIKey | FHPXWACXGTVGBL-LBPRGKRZSA-N |
| XLogP | 2.51 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |