C13H16ClNO2S — CID 171199673
(S)-(3,5-dimethoxyphenyl)-thiophen-3-ylmethanamine;hydrochloride (PubChem CID 171199673) has the molecular formula C13H16ClNO2S and a molecular weight of 285.80 g/mol. Its IUPAC name is (S)-(3,5-dimethoxyphenyl)-thiophen-3-ylmethanamine;hydrochloride.
| Compound Name | (S)-(3,5-dimethoxyphenyl)-thiophen-3-ylmethanamine;hydrochloride |
|---|---|
| PubChem CID | 171199673 |
| Molecular Formula | C13H16ClNO2S |
| Molecular Weight | 285.80 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | (S)-(3,5-dimethoxyphenyl)-thiophen-3-ylmethanamine;hydrochloride |
| SMILES | COc1cc(OC)cc([C@H](N)c2ccsc2)c1.Cl |
| InChI | InChI=1S/C13H15NO2S.ClH/c1-15-11-5-10(6-12(7-11)16-2)13(14)9-3-4-17-8-9;/h3-8,13H,14H2,1-2H3;1H/t13-;/m1./s1 |
| InChIKey | CTLHDGBZGATLTQ-BTQNPOSSSA-N |
| XLogP | 3.24 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.80 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |