C21H28ClNO2 — CID 171213011
(R)-cyclohexyl-(4-methoxy-3-phenylmethoxyphenyl)methanamine;hydrochloride (PubChem CID 171213011) has the molecular formula C21H28ClNO2 and a molecular weight of 361.91 g/mol. Its IUPAC name is (R)-cyclohexyl-(4-methoxy-3-phenylmethoxyphenyl)methanamine;hydrochloride.
| Compound Name | (R)-cyclohexyl-(4-methoxy-3-phenylmethoxyphenyl)methanamine;hydrochloride |
|---|---|
| PubChem CID | 171213011 |
| Molecular Formula | C21H28ClNO2 |
| Molecular Weight | 361.91 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | (R)-cyclohexyl-(4-methoxy-3-phenylmethoxyphenyl)methanamine;hydrochloride |
| SMILES | COc1ccc([C@H](N)C2CCCCC2)cc1OCc1ccccc1.Cl |
| InChI | InChI=1S/C21H27NO2.ClH/c1-23-19-13-12-18(21(22)17-10-6-3-7-11-17)14-20(19)24-15-16-8-4-2-5-9-16;/h2,4-5,8-9,12-14,17,21H,3,6-7,10-11,15,22H2,1H3;1H/t21-;/m1./s1 |
| InChIKey | IQVVNCFWLYTSEA-ZMBIFBSDSA-N |
| XLogP | 5.28 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.91 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |