C19H24ClNO2 — CID 171230032
(S)-cyclopropyl-(3-ethoxy-4-phenylmethoxyphenyl)methanamine;hydrochloride (PubChem CID 171230032) has the molecular formula C19H24ClNO2 and a molecular weight of 333.86 g/mol. Its IUPAC name is (S)-cyclopropyl-(3-ethoxy-4-phenylmethoxyphenyl)methanamine;hydrochloride.
| Compound Name | (S)-cyclopropyl-(3-ethoxy-4-phenylmethoxyphenyl)methanamine;hydrochloride |
|---|---|
| PubChem CID | 171230032 |
| Molecular Formula | C19H24ClNO2 |
| Molecular Weight | 333.86 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | (S)-cyclopropyl-(3-ethoxy-4-phenylmethoxyphenyl)methanamine;hydrochloride |
| SMILES | CCOc1cc([C@@H](N)C2CC2)ccc1OCc1ccccc1.Cl |
| InChI | InChI=1S/C19H23NO2.ClH/c1-2-21-18-12-16(19(20)15-8-9-15)10-11-17(18)22-13-14-6-4-3-5-7-14;/h3-7,10-12,15,19H,2,8-9,13,20H2,1H3;1H/t19-;/m0./s1 |
| InChIKey | NCKNCVBCSCZTGN-FYZYNONXSA-N |
| XLogP | 4.50 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.86 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |