C17H18F3NO2 — CID 66512660
(1S)-1-(3-ethoxy-4-phenylmethoxyphenyl)-2,2,2-trifluoroethanamine (PubChem CID 66512660) has the molecular formula C17H18F3NO2 and a molecular weight of 325.33 g/mol. Its IUPAC name is (1S)-1-(3-ethoxy-4-phenylmethoxyphenyl)-2,2,2-trifluoroethanamine.
| Compound Name | (1S)-1-(3-ethoxy-4-phenylmethoxyphenyl)-2,2,2-trifluoroethanamine |
|---|---|
| PubChem CID | 66512660 |
| Molecular Formula | C17H18F3NO2 |
| Molecular Weight | 325.33 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | (1S)-1-(3-ethoxy-4-phenylmethoxyphenyl)-2,2,2-trifluoroethanamine |
| SMILES | CCOc1cc([C@H](N)C(F)(F)F)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C17H18F3NO2/c1-2-22-15-10-13(16(21)17(18,19)20)8-9-14(15)23-11-12-6-4-3-5-7-12/h3-10,16H,2,11,21H2,1H3/t16-/m0/s1 |
| InChIKey | SPJJEWFRDGEPAQ-INIZCTEOSA-N |
| XLogP | 4.23 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.33 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |