C18H21F2NO2 — CID 171313199
(1S)-1-(3-ethoxy-4-phenylmethoxyphenyl)-3,3-difluoropropan-1-amine (PubChem CID 171313199) has the molecular formula C18H21F2NO2 and a molecular weight of 321.37 g/mol. Its IUPAC name is (1S)-1-(3-ethoxy-4-phenylmethoxyphenyl)-3,3-difluoropropan-1-amine.
| Compound Name | (1S)-1-(3-ethoxy-4-phenylmethoxyphenyl)-3,3-difluoropropan-1-amine |
|---|---|
| PubChem CID | 171313199 |
| Molecular Formula | C18H21F2NO2 |
| Molecular Weight | 321.37 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | (1S)-1-(3-ethoxy-4-phenylmethoxyphenyl)-3,3-difluoropropan-1-amine |
| SMILES | CCOc1cc([C@@H](N)CC(F)F)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C18H21F2NO2/c1-2-22-17-10-14(15(21)11-18(19)20)8-9-16(17)23-12-13-6-4-3-5-7-13/h3-10,15,18H,2,11-12,21H2,1H3/t15-/m0/s1 |
| InChIKey | KIXIXAAHSGSCNU-HNNXBMFYSA-N |
| XLogP | 4.32 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.37 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |