C20H28ClNO2 — CID 171214526
(1R)-1-(3-methoxy-4-phenylmethoxyphenyl)hexan-1-amine;hydrochloride (PubChem CID 171214526) has the molecular formula C20H28ClNO2 and a molecular weight of 349.90 g/mol. Its IUPAC name is (1R)-1-(3-methoxy-4-phenylmethoxyphenyl)hexan-1-amine;hydrochloride.
| Compound Name | (1R)-1-(3-methoxy-4-phenylmethoxyphenyl)hexan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171214526 |
| Molecular Formula | C20H28ClNO2 |
| Molecular Weight | 349.90 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | (1R)-1-(3-methoxy-4-phenylmethoxyphenyl)hexan-1-amine;hydrochloride |
| SMILES | CCCCC[C@@H](N)c1ccc(OCc2ccccc2)c(OC)c1.Cl |
| InChI | InChI=1S/C20H27NO2.ClH/c1-3-4-6-11-18(21)17-12-13-19(20(14-17)22-2)23-15-16-9-7-5-8-10-16;/h5,7-10,12-14,18H,3-4,6,11,15,21H2,1-2H3;1H/t18-;/m1./s1 |
| InChIKey | JIWAQASCDFRXDL-GMUIIQOCSA-N |
| XLogP | 5.28 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.90 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|