C19H26ClNO — CID 171211172
(1R)-1-(4-phenylmethoxyphenyl)hexan-1-amine;hydrochloride (PubChem CID 171211172) has the molecular formula C19H26ClNO and a molecular weight of 319.88 g/mol. Its IUPAC name is (1R)-1-(4-phenylmethoxyphenyl)hexan-1-amine;hydrochloride.
| Compound Name | (1R)-1-(4-phenylmethoxyphenyl)hexan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171211172 |
| Molecular Formula | C19H26ClNO |
| Molecular Weight | 319.88 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | (1R)-1-(4-phenylmethoxyphenyl)hexan-1-amine;hydrochloride |
| SMILES | CCCCC[C@@H](N)c1ccc(OCc2ccccc2)cc1.Cl |
| InChI | InChI=1S/C19H25NO.ClH/c1-2-3-5-10-19(20)17-11-13-18(14-12-17)21-15-16-8-6-4-7-9-16;/h4,6-9,11-14,19H,2-3,5,10,15,20H2,1H3;1H/t19-;/m1./s1 |
| InChIKey | HLVKQTARNXHBEE-FSRHSHDFSA-N |
| XLogP | 5.27 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.88 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|