About 1-phenylhexan-1-amine;hydrochloride
1-phenylhexan-1-amine;hydrochloride (PubChem CID 3033249) has the molecular formula C12H20ClN
and a molecular weight of 213.75 g/mol. Its IUPAC name is 1-phenylhexan-1-amine;hydrochloride.
Molecular Properties
| Compound Name | 1-phenylhexan-1-amine;hydrochloride |
| PubChem CID | 3033249 |
| Molecular Formula | C12H20ClN |
| Molecular Weight | 213.75 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | 1-phenylhexan-1-amine;hydrochloride |
| SMILES | CCCCCC(N)c1ccccc1.Cl |
| InChI | InChI=1S/C12H19N.ClH/c1-2-3-5-10-12(13)11-8-6-4-7-9-11;/h4,6-9,12H,2-3,5,10,13H2,1H3;1H |
| InChIKey | ARNMMAZBPLSECJ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.75 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-phenylhexan-1-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylhexan-1-amine;hydrochloride?
The IUPAC name of 1-phenylhexan-1-amine;hydrochloride (CID 3033249) is 1-phenylhexan-1-amine;hydrochloride.
What is the SMILES notation for 1-phenylhexan-1-amine;hydrochloride?
The canonical SMILES for 1-phenylhexan-1-amine;hydrochloride is CCCCCC(N)c1ccccc1.Cl.
What is the InChIKey of 1-phenylhexan-1-amine;hydrochloride?
The InChIKey is ARNMMAZBPLSECJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N.ClH/c1-2-3-5-10-12(13)11-8-6-4-7-9-11;/h4,6-9,12H,2-3,5,10,13H2,1H3;1H.
What are the key properties of 1-phenylhexan-1-amine;hydrochloride?
1-phenylhexan-1-amine;hydrochloride has a molecular weight of 213.75 g/mol, XLogP of 3.69, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylhexan-1-amine;hydrochloride is sourced from PubChem (CID 3033249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).