About 1-phenylheptadecan-1-amine;hydrobromide
1-phenylheptadecan-1-amine;hydrobromide (PubChem CID 20538047) has the molecular formula C23H42BrN
and a molecular weight of 412.50 g/mol. Its IUPAC name is 1-phenylheptadecan-1-amine;hydrobromide.
Molecular Properties
| Compound Name | 1-phenylheptadecan-1-amine;hydrobromide |
| PubChem CID | 20538047 |
| Molecular Formula | C23H42BrN |
| Molecular Weight | 412.50 g/mol |
| Exact Mass | 411.25 |
| IUPAC Name | 1-phenylheptadecan-1-amine;hydrobromide |
| SMILES | Br.CCCCCCCCCCCCCCCCC(N)c1ccccc1 |
| InChI | InChI=1S/C23H41N.BrH/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-18-21-23(24)22-19-16-15-17-20-22;/h15-17,19-20,23H,2-14,18,21,24H2,1H3;1H |
| InChIKey | CBKZCDAWYOVNMV-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 412.50 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-phenylheptadecan-1-amine;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylheptadecan-1-amine;hydrobromide?
The IUPAC name of 1-phenylheptadecan-1-amine;hydrobromide (CID 20538047) is 1-phenylheptadecan-1-amine;hydrobromide.
What is the SMILES notation for 1-phenylheptadecan-1-amine;hydrobromide?
The canonical SMILES for 1-phenylheptadecan-1-amine;hydrobromide is Br.CCCCCCCCCCCCCCCCC(N)c1ccccc1.
What is the InChIKey of 1-phenylheptadecan-1-amine;hydrobromide?
The InChIKey is CBKZCDAWYOVNMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H41N.BrH/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-18-21-23(24)22-19-16-15-17-20-22;/h15-17,19-20,23H,2-14,18,21,24H2,1H3;1H.
What are the key properties of 1-phenylheptadecan-1-amine;hydrobromide?
1-phenylheptadecan-1-amine;hydrobromide has a molecular weight of 412.50 g/mol, XLogP of 8.14, 16 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylheptadecan-1-amine;hydrobromide is sourced from PubChem (CID 20538047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).