About 1-phenyldecan-1-amine
1-phenyldecan-1-amine (PubChem CID 43175860) has the molecular formula C16H27N
and a molecular weight of 233.40 g/mol. Its IUPAC name is 1-phenyldecan-1-amine.
Molecular Properties
| Compound Name | 1-phenyldecan-1-amine |
| PubChem CID | 43175860 |
| Molecular Formula | C16H27N |
| Molecular Weight | 233.40 g/mol |
| Exact Mass | 233.21 |
| IUPAC Name | 1-phenyldecan-1-amine |
| SMILES | CCCCCCCCCC(N)c1ccccc1 |
| InChI | InChI=1S/C16H27N/c1-2-3-4-5-6-7-11-14-16(17)15-12-9-8-10-13-15/h8-10,12-13,16H,2-7,11,14,17H2,1H3 |
| InChIKey | BDJDLXLECSMEFA-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.40 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-phenyldecan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenyldecan-1-amine?
The IUPAC name of 1-phenyldecan-1-amine (CID 43175860) is 1-phenyldecan-1-amine.
What is the SMILES notation for 1-phenyldecan-1-amine?
The canonical SMILES for 1-phenyldecan-1-amine is CCCCCCCCCC(N)c1ccccc1.
What is the InChIKey of 1-phenyldecan-1-amine?
The InChIKey is BDJDLXLECSMEFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H27N/c1-2-3-4-5-6-7-11-14-16(17)15-12-9-8-10-13-15/h8-10,12-13,16H,2-7,11,14,17H2,1H3.
What are the key properties of 1-phenyldecan-1-amine?
1-phenyldecan-1-amine has a molecular weight of 233.40 g/mol, XLogP of 4.83, 9 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenyldecan-1-amine is sourced from PubChem (CID 43175860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).