C19H34N2 — CID 174264549
N'-ethyl-N'-heptyl-1-phenylbutane-1,4-diamine (PubChem CID 174264549) has the molecular formula C19H34N2 and a molecular weight of 290.49 g/mol. Its IUPAC name is N'-ethyl-N'-heptyl-1-phenylbutane-1,4-diamine.
| Compound Name | N'-ethyl-N'-heptyl-1-phenylbutane-1,4-diamine |
|---|---|
| PubChem CID | 174264549 |
| Molecular Formula | C19H34N2 |
| Molecular Weight | 290.49 g/mol |
| Exact Mass | 290.27 |
| IUPAC Name | N'-ethyl-N'-heptyl-1-phenylbutane-1,4-diamine |
| SMILES | CCCCCCCN(CC)CCCC(N)c1ccccc1 |
| InChI | InChI=1S/C19H34N2/c1-3-5-6-7-11-16-21(4-2)17-12-15-19(20)18-13-9-8-10-14-18/h8-10,13-14,19H,3-7,11-12,15-17,20H2,1-2H3 |
| InChIKey | KKZVVVJCXIOAHF-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.49 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|