C17H31N3 — CID 102992514
N'-(2-amino-2-phenylethyl)-N,N,N'-triethylpropane-1,3-diamine (PubChem CID 102992514) has the molecular formula C17H31N3 and a molecular weight of 277.46 g/mol. Its IUPAC name is N'-(2-amino-2-phenylethyl)-N,N,N'-triethylpropane-1,3-diamine.
| Compound Name | N'-(2-amino-2-phenylethyl)-N,N,N'-triethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 102992514 |
| Molecular Formula | C17H31N3 |
| Molecular Weight | 277.46 g/mol |
| Exact Mass | 277.25 |
| IUPAC Name | N'-(2-amino-2-phenylethyl)-N,N,N'-triethylpropane-1,3-diamine |
| SMILES | CCN(CC)CCCN(CC)CC(N)c1ccccc1 |
| InChI | InChI=1S/C17H31N3/c1-4-19(5-2)13-10-14-20(6-3)15-17(18)16-11-8-7-9-12-16/h7-9,11-12,17H,4-6,10,13-15,18H2,1-3H3 |
| InChIKey | QPBVHUJEUMIXJW-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.46 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |