C15H26N2O — CID 18070854
N'-butyl-N'-ethyl-1-(2-methoxyphenyl)ethane-1,2-diamine (PubChem CID 18070854) has the molecular formula C15H26N2O and a molecular weight of 250.39 g/mol. Its IUPAC name is N'-butyl-N'-ethyl-1-(2-methoxyphenyl)ethane-1,2-diamine.
| Compound Name | N'-butyl-N'-ethyl-1-(2-methoxyphenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 18070854 |
| Molecular Formula | C15H26N2O |
| Molecular Weight | 250.39 g/mol |
| Exact Mass | 250.20 |
| IUPAC Name | N'-butyl-N'-ethyl-1-(2-methoxyphenyl)ethane-1,2-diamine |
| SMILES | CCCCN(CC)CC(N)c1ccccc1OC |
| InChI | InChI=1S/C15H26N2O/c1-4-6-11-17(5-2)12-14(16)13-9-7-8-10-15(13)18-3/h7-10,14H,4-6,11-12,16H2,1-3H3 |
| InChIKey | LLFAGXHNXFLWCM-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.39 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |