C14H24N2O — CID 62264739
1-(2-aminophenyl)-2-[butyl(ethyl)amino]ethanol (PubChem CID 62264739) has the molecular formula C14H24N2O and a molecular weight of 236.36 g/mol. Its IUPAC name is 1-(2-aminophenyl)-2-[butyl(ethyl)amino]ethanol.
| Compound Name | 1-(2-aminophenyl)-2-[butyl(ethyl)amino]ethanol |
|---|---|
| PubChem CID | 62264739 |
| Molecular Formula | C14H24N2O |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.19 |
| IUPAC Name | 1-(2-aminophenyl)-2-[butyl(ethyl)amino]ethanol |
| SMILES | CCCCN(CC)CC(O)c1ccccc1N |
| InChI | InChI=1S/C14H24N2O/c1-3-5-10-16(4-2)11-14(17)12-8-6-7-9-13(12)15/h6-9,14,17H,3-5,10-11,15H2,1-2H3 |
| InChIKey | RJMIAIROWIYRJT-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|