C12H20N2O2 — CID 62266300
1-(2-aminophenyl)-2-[ethyl(2-hydroxyethyl)amino]ethanol (PubChem CID 62266300) has the molecular formula C12H20N2O2 and a molecular weight of 224.30 g/mol. Its IUPAC name is 1-(2-aminophenyl)-2-[ethyl(2-hydroxyethyl)amino]ethanol.
| Compound Name | 1-(2-aminophenyl)-2-[ethyl(2-hydroxyethyl)amino]ethanol |
|---|---|
| PubChem CID | 62266300 |
| Molecular Formula | C12H20N2O2 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | 1-(2-aminophenyl)-2-[ethyl(2-hydroxyethyl)amino]ethanol |
| SMILES | CCN(CCO)CC(O)c1ccccc1N |
| InChI | InChI=1S/C12H20N2O2/c1-2-14(7-8-15)9-12(16)10-5-3-4-6-11(10)13/h3-6,12,15-16H,2,7-9,13H2,1H3 |
| InChIKey | OTPYNJXWQFTTQI-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|