C12H17F2NO2 — CID 82217059
1-(2,5-difluorophenyl)-2-[ethyl(2-hydroxyethyl)amino]ethanol (PubChem CID 82217059) has the molecular formula C12H17F2NO2 and a molecular weight of 245.27 g/mol. Its IUPAC name is 1-(2,5-difluorophenyl)-2-[ethyl(2-hydroxyethyl)amino]ethanol.
| Compound Name | 1-(2,5-difluorophenyl)-2-[ethyl(2-hydroxyethyl)amino]ethanol |
|---|---|
| PubChem CID | 82217059 |
| Molecular Formula | C12H17F2NO2 |
| Molecular Weight | 245.27 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | 1-(2,5-difluorophenyl)-2-[ethyl(2-hydroxyethyl)amino]ethanol |
| SMILES | CCN(CCO)CC(O)c1cc(F)ccc1F |
| InChI | InChI=1S/C12H17F2NO2/c1-2-15(5-6-16)8-12(17)10-7-9(13)3-4-11(10)14/h3-4,7,12,16-17H,2,5-6,8H2,1H3 |
| InChIKey | HGDAMFNKEDCDAE-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.27 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |