C12H17F2NO3 — CID 82217071
2-[bis(2-hydroxyethyl)amino]-1-(3,4-difluorophenyl)ethanol (PubChem CID 82217071) has the molecular formula C12H17F2NO3 and a molecular weight of 261.27 g/mol. Its IUPAC name is 2-[bis(2-hydroxyethyl)amino]-1-(3,4-difluorophenyl)ethanol.
| Compound Name | 2-[bis(2-hydroxyethyl)amino]-1-(3,4-difluorophenyl)ethanol |
|---|---|
| PubChem CID | 82217071 |
| Molecular Formula | C12H17F2NO3 |
| Molecular Weight | 261.27 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | 2-[bis(2-hydroxyethyl)amino]-1-(3,4-difluorophenyl)ethanol |
| SMILES | OCCN(CCO)CC(O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C12H17F2NO3/c13-10-2-1-9(7-11(10)14)12(18)8-15(3-5-16)4-6-17/h1-2,7,12,16-18H,3-6,8H2 |
| InChIKey | FBIDFWFJFBSHGJ-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.27 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |