C10H13F2NO — CID 82048635
4-amino-1-(3,4-difluorophenyl)butan-1-ol (PubChem CID 82048635) has the molecular formula C10H13F2NO and a molecular weight of 201.22 g/mol. Its IUPAC name is 4-amino-1-(3,4-difluorophenyl)butan-1-ol.
| Compound Name | 4-amino-1-(3,4-difluorophenyl)butan-1-ol |
|---|---|
| PubChem CID | 82048635 |
| Molecular Formula | C10H13F2NO |
| Molecular Weight | 201.22 g/mol |
| Exact Mass | 201.10 |
| IUPAC Name | 4-amino-1-(3,4-difluorophenyl)butan-1-ol |
| SMILES | NCCCC(O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C10H13F2NO/c11-8-4-3-7(6-9(8)12)10(14)2-1-5-13/h3-4,6,10,14H,1-2,5,13H2 |
| InChIKey | IKKNXCRACFPCHA-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.22 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |