C16H25F2NO — CID 82217067
2-[bis(2-methylpropyl)amino]-1-(3,4-difluorophenyl)ethanol (PubChem CID 82217067) has the molecular formula C16H25F2NO and a molecular weight of 285.38 g/mol. Its IUPAC name is 2-[bis(2-methylpropyl)amino]-1-(3,4-difluorophenyl)ethanol.
| Compound Name | 2-[bis(2-methylpropyl)amino]-1-(3,4-difluorophenyl)ethanol |
|---|---|
| PubChem CID | 82217067 |
| Molecular Formula | C16H25F2NO |
| Molecular Weight | 285.38 g/mol |
| Exact Mass | 285.19 |
| IUPAC Name | 2-[bis(2-methylpropyl)amino]-1-(3,4-difluorophenyl)ethanol |
| SMILES | CC(C)CN(CC(C)C)CC(O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C16H25F2NO/c1-11(2)8-19(9-12(3)4)10-16(20)13-5-6-14(17)15(18)7-13/h5-7,11-12,16,20H,8-10H2,1-4H3 |
| InChIKey | PXEMLGWBIMGGMS-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.38 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |