C15H21F2NO — CID 110898003
2-[cyclopentyl(ethyl)amino]-1-(3,4-difluorophenyl)ethanol (PubChem CID 110898003) has the molecular formula C15H21F2NO and a molecular weight of 269.33 g/mol. Its IUPAC name is 2-[cyclopentyl(ethyl)amino]-1-(3,4-difluorophenyl)ethanol.
| Compound Name | 2-[cyclopentyl(ethyl)amino]-1-(3,4-difluorophenyl)ethanol |
|---|---|
| PubChem CID | 110898003 |
| Molecular Formula | C15H21F2NO |
| Molecular Weight | 269.33 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | 2-[cyclopentyl(ethyl)amino]-1-(3,4-difluorophenyl)ethanol |
| SMILES | CCN(CC(O)c1ccc(F)c(F)c1)C1CCCC1 |
| InChI | InChI=1S/C15H21F2NO/c1-2-18(12-5-3-4-6-12)10-15(19)11-7-8-13(16)14(17)9-11/h7-9,12,15,19H,2-6,10H2,1H3 |
| InChIKey | RODIDVGIYMGOBF-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.33 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |