C13H17F2NO — CID 110897812
2-[cyclopropyl(ethyl)amino]-1-(2,6-difluorophenyl)ethanol (PubChem CID 110897812) has the molecular formula C13H17F2NO and a molecular weight of 241.28 g/mol. Its IUPAC name is 2-[cyclopropyl(ethyl)amino]-1-(2,6-difluorophenyl)ethanol.
| Compound Name | 2-[cyclopropyl(ethyl)amino]-1-(2,6-difluorophenyl)ethanol |
|---|---|
| PubChem CID | 110897812 |
| Molecular Formula | C13H17F2NO |
| Molecular Weight | 241.28 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | 2-[cyclopropyl(ethyl)amino]-1-(2,6-difluorophenyl)ethanol |
| SMILES | CCN(CC(O)c1c(F)cccc1F)C1CC1 |
| InChI | InChI=1S/C13H17F2NO/c1-2-16(9-6-7-9)8-12(17)13-10(14)4-3-5-11(13)15/h3-5,9,12,17H,2,6-8H2,1H3 |
| InChIKey | LRXZXLVYZVGSDM-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.28 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |