C9H9BrF2 — CID 66469255
4-(1-bromopropan-2-yl)-1,2-difluorobenzene (PubChem CID 66469255) has the molecular formula C9H9BrF2 and a molecular weight of 235.07 g/mol. Its IUPAC name is 4-(1-bromopropan-2-yl)-1,2-difluorobenzene.
| Compound Name | 4-(1-bromopropan-2-yl)-1,2-difluorobenzene |
|---|---|
| PubChem CID | 66469255 |
| Molecular Formula | C9H9BrF2 |
| Molecular Weight | 235.07 g/mol |
| Exact Mass | 233.99 |
| IUPAC Name | 4-(1-bromopropan-2-yl)-1,2-difluorobenzene |
| SMILES | CC(CBr)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C9H9BrF2/c1-6(5-10)7-2-3-8(11)9(12)4-7/h2-4,6H,5H2,1H3 |
| InChIKey | VJJTWVBSZNWGBA-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.07 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|