C12H18F2 — CID 143774679
1,2-difluoro-4-propan-2-ylbenzene;propane (PubChem CID 143774679) has the molecular formula C12H18F2 and a molecular weight of 200.27 g/mol. Its IUPAC name is 1,2-difluoro-4-propan-2-ylbenzene;propane.
| Compound Name | 1,2-difluoro-4-propan-2-ylbenzene;propane |
|---|---|
| PubChem CID | 143774679 |
| Molecular Formula | C12H18F2 |
| Molecular Weight | 200.27 g/mol |
| Exact Mass | 200.14 |
| IUPAC Name | 1,2-difluoro-4-propan-2-ylbenzene;propane |
| SMILES | CC(C)c1ccc(F)c(F)c1.CCC |
| InChI | InChI=1S/C9H10F2.C3H8/c1-6(2)7-3-4-8(10)9(11)5-7;1-3-2/h3-6H,1-2H3;3H2,1-2H3 |
| InChIKey | YWRNXFLTBRZKCX-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.27 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |