C13H19F2N — CID 83936159
6-(3,4-difluorophenyl)heptan-3-amine (PubChem CID 83936159) has the molecular formula C13H19F2N and a molecular weight of 227.30 g/mol. Its IUPAC name is 6-(3,4-difluorophenyl)heptan-3-amine.
| Compound Name | 6-(3,4-difluorophenyl)heptan-3-amine |
|---|---|
| PubChem CID | 83936159 |
| Molecular Formula | C13H19F2N |
| Molecular Weight | 227.30 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | 6-(3,4-difluorophenyl)heptan-3-amine |
| SMILES | CCC(N)CCC(C)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C13H19F2N/c1-3-11(16)6-4-9(2)10-5-7-12(14)13(15)8-10/h5,7-9,11H,3-4,6,16H2,1-2H3 |
| InChIKey | ANHNRGCYIAEQAN-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.30 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |