C12H18ClF2N — CID 86262840
1-(3,4-difluorophenyl)hexan-1-amine;hydrochloride (PubChem CID 86262840) has the molecular formula C12H18ClF2N and a molecular weight of 249.73 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)hexan-1-amine;hydrochloride.
| Compound Name | 1-(3,4-difluorophenyl)hexan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 86262840 |
| Molecular Formula | C12H18ClF2N |
| Molecular Weight | 249.73 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | 1-(3,4-difluorophenyl)hexan-1-amine;hydrochloride |
| SMILES | CCCCCC(N)c1ccc(F)c(F)c1.Cl |
| InChI | InChI=1S/C12H17F2N.ClH/c1-2-3-4-5-12(15)9-6-7-10(13)11(14)8-9;/h6-8,12H,2-5,15H2,1H3;1H |
| InChIKey | UFGMFQUTSPUOEZ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.73 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|