C16H16F2 — CID 177076550
1,2-difluoro-4-[(4-propan-2-ylphenyl)methyl]benzene (PubChem CID 177076550) has the molecular formula C16H16F2 and a molecular weight of 246.30 g/mol. Its IUPAC name is 1,2-difluoro-4-[(4-propan-2-ylphenyl)methyl]benzene.
| Compound Name | 1,2-difluoro-4-[(4-propan-2-ylphenyl)methyl]benzene |
|---|---|
| PubChem CID | 177076550 |
| Molecular Formula | C16H16F2 |
| Molecular Weight | 246.30 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | 1,2-difluoro-4-[(4-propan-2-ylphenyl)methyl]benzene |
| SMILES | CC(C)c1ccc(Cc2ccc(F)c(F)c2)cc1 |
| InChI | InChI=1S/C16H16F2/c1-11(2)14-6-3-12(4-7-14)9-13-5-8-15(17)16(18)10-13/h3-8,10-11H,9H2,1-2H3 |
| InChIKey | MVVSGHZEIFFVJS-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.30 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |