C19H21F2NO — CID 141065141
2-[benzyl-[(2R)-2-(3,4-difluorophenyl)but-3-enyl]amino]ethanol (PubChem CID 141065141) has the molecular formula C19H21F2NO and a molecular weight of 317.38 g/mol. Its IUPAC name is 2-[benzyl-[(2R)-2-(3,4-difluorophenyl)but-3-enyl]amino]ethanol.
| Compound Name | 2-[benzyl-[(2R)-2-(3,4-difluorophenyl)but-3-enyl]amino]ethanol |
|---|---|
| PubChem CID | 141065141 |
| Molecular Formula | C19H21F2NO |
| Molecular Weight | 317.38 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | 2-[benzyl-[(2R)-2-(3,4-difluorophenyl)but-3-enyl]amino]ethanol |
| SMILES | C=C[C@@H](CN(CCO)Cc1ccccc1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C19H21F2NO/c1-2-16(17-8-9-18(20)19(21)12-17)14-22(10-11-23)13-15-6-4-3-5-7-15/h2-9,12,16,23H,1,10-11,13-14H2/t16-/m0/s1 |
| InChIKey | ZFPXFKROYMXLJN-INIZCTEOSA-N |
| XLogP | 3.73 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.38 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|