C17H19F2NO2 — CID 94957732
(1R)-2-[benzyl(2-hydroxyethyl)amino]-1-(2,5-difluorophenyl)ethanol (PubChem CID 94957732) has the molecular formula C17H19F2NO2 and a molecular weight of 307.34 g/mol. Its IUPAC name is (1R)-2-[benzyl(2-hydroxyethyl)amino]-1-(2,5-difluorophenyl)ethanol.
| Compound Name | (1R)-2-[benzyl(2-hydroxyethyl)amino]-1-(2,5-difluorophenyl)ethanol |
|---|---|
| PubChem CID | 94957732 |
| Molecular Formula | C17H19F2NO2 |
| Molecular Weight | 307.34 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | (1R)-2-[benzyl(2-hydroxyethyl)amino]-1-(2,5-difluorophenyl)ethanol |
| SMILES | OCCN(Cc1ccccc1)C[C@H](O)c1cc(F)ccc1F |
| InChI | InChI=1S/C17H19F2NO2/c18-14-6-7-16(19)15(10-14)17(22)12-20(8-9-21)11-13-4-2-1-3-5-13/h1-7,10,17,21-22H,8-9,11-12H2/t17-/m0/s1 |
| InChIKey | JAJGVTQDKVCQLH-KRWDZBQOSA-N |
| XLogP | 2.49 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.34 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |