C16H27NO3 — CID 54202993
7-[benzyl(2-hydroxyethyl)amino]heptane-1,6-diol (PubChem CID 54202993) has the molecular formula C16H27NO3 and a molecular weight of 281.40 g/mol. Its IUPAC name is 7-[benzyl(2-hydroxyethyl)amino]heptane-1,6-diol.
| Compound Name | 7-[benzyl(2-hydroxyethyl)amino]heptane-1,6-diol |
|---|---|
| PubChem CID | 54202993 |
| Molecular Formula | C16H27NO3 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.20 |
| IUPAC Name | 7-[benzyl(2-hydroxyethyl)amino]heptane-1,6-diol |
| SMILES | OCCCCCC(O)CN(CCO)Cc1ccccc1 |
| InChI | InChI=1S/C16H27NO3/c18-11-6-2-5-9-16(20)14-17(10-12-19)13-15-7-3-1-4-8-15/h1,3-4,7-8,16,18-20H,2,5-6,9-14H2 |
| InChIKey | ZOSJNTIGCSTOGL-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|