C12H19NO3 — CID 3825046
3-[benzyl(2-hydroxyethyl)amino]propane-1,2-diol (PubChem CID 3825046) has the molecular formula C12H19NO3 and a molecular weight of 225.29 g/mol. Its IUPAC name is 3-[benzyl(2-hydroxyethyl)amino]propane-1,2-diol.
| Compound Name | 3-[benzyl(2-hydroxyethyl)amino]propane-1,2-diol |
|---|---|
| PubChem CID | 3825046 |
| Molecular Formula | C12H19NO3 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.14 |
| IUPAC Name | 3-[benzyl(2-hydroxyethyl)amino]propane-1,2-diol |
| SMILES | OCCN(Cc1ccccc1)CC(O)CO |
| InChI | InChI=1S/C12H19NO3/c14-7-6-13(9-12(16)10-15)8-11-4-2-1-3-5-11/h1-5,12,14-16H,6-10H2 |
| InChIKey | YJGOFSMFFFGRGJ-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |