C22H31ClNO3- — CID 21237867
1-[benzyl(2-hydroxyethyl)amino]-3-(2-tert-butylphenoxy)propan-2-ol chloride (PubChem CID 21237867) has the molecular formula C22H31ClNO3- and a molecular weight of 392.95 g/mol. Its IUPAC name is 1-[benzyl(2-hydroxyethyl)amino]-3-(2-tert-butylphenoxy)propan-2-ol chloride.
| Compound Name | 1-[benzyl(2-hydroxyethyl)amino]-3-(2-tert-butylphenoxy)propan-2-ol chloride |
|---|---|
| PubChem CID | 21237867 |
| Molecular Formula | C22H31ClNO3- |
| Molecular Weight | 392.95 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | 1-[benzyl(2-hydroxyethyl)amino]-3-(2-tert-butylphenoxy)propan-2-ol chloride |
| SMILES | CC(C)(C)c1ccccc1OCC(O)CN(CCO)Cc1ccccc1.[Cl-] |
| InChI | InChI=1S/C22H31NO3.ClH/c1-22(2,3)20-11-7-8-12-21(20)26-17-19(25)16-23(13-14-24)15-18-9-5-4-6-10-18;/h4-12,19,24-25H,13-17H2,1-3H3;1H/p-1 |
| InChIKey | AJJUCDHWXPUZPB-UHFFFAOYSA-M |
| XLogP | 0.22 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.95 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |