C22H31NO3 — CID 30050572
(2R)-1-[benzyl(2-hydroxyethyl)amino]-3-(2-tert-butylphenoxy)propan-2-ol (PubChem CID 30050572) has the molecular formula C22H31NO3 and a molecular weight of 357.49 g/mol. Its IUPAC name is (2R)-1-[benzyl(2-hydroxyethyl)amino]-3-(2-tert-butylphenoxy)propan-2-ol.
| Compound Name | (2R)-1-[benzyl(2-hydroxyethyl)amino]-3-(2-tert-butylphenoxy)propan-2-ol |
|---|---|
| PubChem CID | 30050572 |
| Molecular Formula | C22H31NO3 |
| Molecular Weight | 357.49 g/mol |
| Exact Mass | 357.23 |
| IUPAC Name | (2R)-1-[benzyl(2-hydroxyethyl)amino]-3-(2-tert-butylphenoxy)propan-2-ol |
| SMILES | CC(C)(C)c1ccccc1OC[C@H](O)CN(CCO)Cc1ccccc1 |
| InChI | InChI=1S/C22H31NO3/c1-22(2,3)20-11-7-8-12-21(20)26-17-19(25)16-23(13-14-24)15-18-9-5-4-6-10-18/h4-12,19,24-25H,13-17H2,1-3H3/t19-/m1/s1 |
| InChIKey | QBYIVLSRKSVPKE-LJQANCHMSA-N |
| XLogP | 3.22 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.49 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |