C14H23NO3S — CID 154376449
3-[2-benzylsulfanylethyl(2-hydroxyethyl)amino]propane-1,2-diol (PubChem CID 154376449) has the molecular formula C14H23NO3S and a molecular weight of 285.41 g/mol. Its IUPAC name is 3-[2-benzylsulfanylethyl(2-hydroxyethyl)amino]propane-1,2-diol.
| Compound Name | 3-[2-benzylsulfanylethyl(2-hydroxyethyl)amino]propane-1,2-diol |
|---|---|
| PubChem CID | 154376449 |
| Molecular Formula | C14H23NO3S |
| Molecular Weight | 285.41 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | 3-[2-benzylsulfanylethyl(2-hydroxyethyl)amino]propane-1,2-diol |
| SMILES | OCCN(CCSCc1ccccc1)CC(O)CO |
| InChI | InChI=1S/C14H23NO3S/c16-8-6-15(10-14(18)11-17)7-9-19-12-13-4-2-1-3-5-13/h1-5,14,16-18H,6-12H2 |
| InChIKey | ISKDAGWZNKBYOL-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.41 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|