C21H37NO5 — CID 173440308
3-[benzyl(octyl)amino]propane-1,2-diol;2-hydroxypropanoic acid (PubChem CID 173440308) has the molecular formula C21H37NO5 and a molecular weight of 383.53 g/mol. Its IUPAC name is 3-[benzyl(octyl)amino]propane-1,2-diol;2-hydroxypropanoic acid.
| Compound Name | 3-[benzyl(octyl)amino]propane-1,2-diol;2-hydroxypropanoic acid |
|---|---|
| PubChem CID | 173440308 |
| Molecular Formula | C21H37NO5 |
| Molecular Weight | 383.53 g/mol |
| Exact Mass | 383.27 |
| IUPAC Name | 3-[benzyl(octyl)amino]propane-1,2-diol;2-hydroxypropanoic acid |
| SMILES | CC(O)C(=O)O.CCCCCCCCN(Cc1ccccc1)CC(O)CO |
| InChI | InChI=1S/C18H31NO2.C3H6O3/c1-2-3-4-5-6-10-13-19(15-18(21)16-20)14-17-11-8-7-9-12-17;1-2(4)3(5)6/h7-9,11-12,18,20-21H,2-6,10,13-16H2,1H3;2,4H,1H3,(H,5,6) |
| InChIKey | MZONRTDGVIOHSY-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 101.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.53 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|