C17H37NO3 — CID 98095005
(2R)-3-[dodecyl(2-hydroxyethyl)amino]propane-1,2-diol (PubChem CID 98095005) has the molecular formula C17H37NO3 and a molecular weight of 303.49 g/mol. Its IUPAC name is (2R)-3-[dodecyl(2-hydroxyethyl)amino]propane-1,2-diol.
| Compound Name | (2R)-3-[dodecyl(2-hydroxyethyl)amino]propane-1,2-diol |
|---|---|
| PubChem CID | 98095005 |
| Molecular Formula | C17H37NO3 |
| Molecular Weight | 303.49 g/mol |
| Exact Mass | 303.28 |
| IUPAC Name | (2R)-3-[dodecyl(2-hydroxyethyl)amino]propane-1,2-diol |
| SMILES | CCCCCCCCCCCCN(CCO)C[C@@H](O)CO |
| InChI | InChI=1S/C17H37NO3/c1-2-3-4-5-6-7-8-9-10-11-12-18(13-14-19)15-17(21)16-20/h17,19-21H,2-16H2,1H3/t17-/m1/s1 |
| InChIKey | NXWRADQGCVGQIY-QGZVFWFLSA-N |
| XLogP | 2.55 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.49 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|