C17H35NO4 — CID 101275334
3-[2,3-dihydroxypropyl-[(E)-undec-4-enyl]amino]propane-1,2-diol (PubChem CID 101275334) has the molecular formula C17H35NO4 and a molecular weight of 317.47 g/mol. Its IUPAC name is 3-[2,3-dihydroxypropyl-[(E)-undec-4-enyl]amino]propane-1,2-diol.
| Compound Name | 3-[2,3-dihydroxypropyl-[(E)-undec-4-enyl]amino]propane-1,2-diol |
|---|---|
| PubChem CID | 101275334 |
| Molecular Formula | C17H35NO4 |
| Molecular Weight | 317.47 g/mol |
| Exact Mass | 317.26 |
| IUPAC Name | 3-[2,3-dihydroxypropyl-[(E)-undec-4-enyl]amino]propane-1,2-diol |
| SMILES | CCCCCC/C=C/CCCN(CC(O)CO)CC(O)CO |
| InChI | InChI=1S/C17H35NO4/c1-2-3-4-5-6-7-8-9-10-11-18(12-16(21)14-19)13-17(22)15-20/h7-8,16-17,19-22H,2-6,9-15H2,1H3/b8-7+ |
| InChIKey | XTPYCLDCUQDYTL-BQYQJAHWSA-N |
| XLogP | 1.30 |
| TPSA | 84.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.47 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|