C18H39NO4 — CID 91864838
(2S)-3-[[(2S)-2,3-dihydroxypropyl]-dodecylamino]propane-1,2-diol (PubChem CID 91864838) has the molecular formula C18H39NO4 and a molecular weight of 333.51 g/mol. Its IUPAC name is (2S)-3-[[(2S)-2,3-dihydroxypropyl]-dodecylamino]propane-1,2-diol.
| Compound Name | (2S)-3-[[(2S)-2,3-dihydroxypropyl]-dodecylamino]propane-1,2-diol |
|---|---|
| PubChem CID | 91864838 |
| Molecular Formula | C18H39NO4 |
| Molecular Weight | 333.51 g/mol |
| Exact Mass | 333.29 |
| IUPAC Name | (2S)-3-[[(2S)-2,3-dihydroxypropyl]-dodecylamino]propane-1,2-diol |
| SMILES | CCCCCCCCCCCCN(C[C@H](O)CO)C[C@H](O)CO |
| InChI | InChI=1S/C18H39NO4/c1-2-3-4-5-6-7-8-9-10-11-12-19(13-17(22)15-20)14-18(23)16-21/h17-18,20-23H,2-16H2,1H3/t17-,18-/m0/s1 |
| InChIKey | MVKAHJLPJBMCFN-ROUUACIJSA-N |
| XLogP | 1.92 |
| TPSA | 84.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.51 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|