C12H28N2O2 — CID 102995838
3-[3-(diethylamino)propyl-ethylamino]propane-1,2-diol (PubChem CID 102995838) has the molecular formula C12H28N2O2 and a molecular weight of 232.37 g/mol. Its IUPAC name is 3-[3-(diethylamino)propyl-ethylamino]propane-1,2-diol.
| Compound Name | 3-[3-(diethylamino)propyl-ethylamino]propane-1,2-diol |
|---|---|
| PubChem CID | 102995838 |
| Molecular Formula | C12H28N2O2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.22 |
| IUPAC Name | 3-[3-(diethylamino)propyl-ethylamino]propane-1,2-diol |
| SMILES | CCN(CC)CCCN(CC)CC(O)CO |
| InChI | InChI=1S/C12H28N2O2/c1-4-13(5-2)8-7-9-14(6-3)10-12(16)11-15/h12,15-16H,4-11H2,1-3H3 |
| InChIKey | KUEQLWVFHTWJOB-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |