About 6-(diethylamino)hexane-1,2-diol
6-(diethylamino)hexane-1,2-diol (PubChem CID 18995566) has the molecular formula C10H23NO2
and a molecular weight of 189.30 g/mol. Its IUPAC name is 6-(diethylamino)hexane-1,2-diol.
Molecular Properties
| Compound Name | 6-(diethylamino)hexane-1,2-diol |
| PubChem CID | 18995566 |
| Molecular Formula | C10H23NO2 |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.17 |
| IUPAC Name | 6-(diethylamino)hexane-1,2-diol |
| SMILES | CCN(CC)CCCCC(O)CO |
| InChI | InChI=1S/C10H23NO2/c1-3-11(4-2)8-6-5-7-10(13)9-12/h10,12-13H,3-9H2,1-2H3 |
| InChIKey | AOGNBZUNYPRTLJ-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-(diethylamino)hexane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(diethylamino)hexane-1,2-diol?
The IUPAC name of 6-(diethylamino)hexane-1,2-diol (CID 18995566) is 6-(diethylamino)hexane-1,2-diol.
What is the SMILES notation for 6-(diethylamino)hexane-1,2-diol?
The canonical SMILES for 6-(diethylamino)hexane-1,2-diol is CCN(CC)CCCCC(O)CO.
What is the InChIKey of 6-(diethylamino)hexane-1,2-diol?
The InChIKey is AOGNBZUNYPRTLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H23NO2/c1-3-11(4-2)8-6-5-7-10(13)9-12/h10,12-13H,3-9H2,1-2H3.
What are the key properties of 6-(diethylamino)hexane-1,2-diol?
6-(diethylamino)hexane-1,2-diol has a molecular weight of 189.30 g/mol, XLogP of 0.85, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(diethylamino)hexane-1,2-diol is sourced from PubChem (CID 18995566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).