C47H92N4O2 — CID 155602039
1-amino-3-[5-[(3-amino-2-hydroxypropyl)-[(9E,12E)-octadeca-9,12-dienyl]amino]pentyl-[(9E,12Z)-octadeca-9,12-dienyl]amino]propan-2-ol (PubChem CID 155602039) has the molecular formula C47H92N4O2 and a molecular weight of 745.28 g/mol. Its IUPAC name is 1-amino-3-[5-[(3-amino-2-hydroxypropyl)-[(9E,12E)-octadeca-9,12-dienyl]amino]pentyl-[(9E,12Z)-octadeca-9,12-dienyl]amino]propan-2-ol.
| Compound Name | 1-amino-3-[5-[(3-amino-2-hydroxypropyl)-[(9E,12E)-octadeca-9,12-dienyl]amino]pentyl-[(9E,12Z)-octadeca-9,12-dienyl]amino]propan-2-ol |
|---|---|
| PubChem CID | 155602039 |
| Molecular Formula | C47H92N4O2 |
| Molecular Weight | 745.28 g/mol |
| Exact Mass | 744.72 |
| IUPAC Name | 1-amino-3-[5-[(3-amino-2-hydroxypropyl)-[(9E,12E)-octadeca-9,12-dienyl]amino]pentyl-[(9E,12Z)-octadeca-9,12-dienyl]amino]propan-2-ol |
| SMILES | CCCCC/C=C\C/C=C/CCCCCCCCN(CCCCCN(CCCCCCCC/C=C/C/C=C/CCCCC)CC(O)CN)CC(O)CN |
| InChI | InChI=1S/C47H92N4O2/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-34-38-50(44-46(52)42-48)40-36-33-37-41-51(45-47(53)43-49)39-35-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h11-14,17-20,46-47,52-53H,3-10,15-16,21-45,48-49H2,1-2H3/b13-11-,14-12+,19-17+,20-18+ |
| InChIKey | MZPZPLFPZDTBDS-KCOASDAESA-N |
| XLogP | 11.03 |
| TPSA | 98.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.28 |
| LogP ≤ 5 | 11.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|