C60H114N4O2 — CID 166846178
(11Z)-1-amino-4-[2-[3-[(3-amino-2-hydroxypropyl)-[(10Z)-hexadeca-7,10-dienyl]amino]propyl-[(7Z)-hexadeca-7,10-dienyl]amino]ethyl]icosa-11,14-dien-2-ol (PubChem CID 166846178) has the molecular formula C60H114N4O2 and a molecular weight of 923.60 g/mol. Its IUPAC name is (11Z)-1-amino-4-[2-[3-[(3-amino-2-hydroxypropyl)-[(10Z)-hexadeca-7,10-dienyl]amino]propyl-[(7Z)-hexadeca-7,10-dienyl]amino]ethyl]icosa-11,14-dien-2-ol.
| Compound Name | (11Z)-1-amino-4-[2-[3-[(3-amino-2-hydroxypropyl)-[(10Z)-hexadeca-7,10-dienyl]amino]propyl-[(7Z)-hexadeca-7,10-dienyl]amino]ethyl]icosa-11,14-dien-2-ol |
|---|---|
| PubChem CID | 166846178 |
| Molecular Formula | C60H114N4O2 |
| Molecular Weight | 923.60 g/mol |
| Exact Mass | 922.89 |
| IUPAC Name | (11Z)-1-amino-4-[2-[3-[(3-amino-2-hydroxypropyl)-[(10Z)-hexadeca-7,10-dienyl]amino]propyl-[(7Z)-hexadeca-7,10-dienyl]amino]ethyl]icosa-11,14-dien-2-ol |
| SMILES | CCCCCC=CC/C=C\CCCCCCC(CCN(CCCCCC/C=C\CC=CCCCCC)CCCN(CCCCCCC=CC/C=C\CCCCC)CC(O)CN)CC(O)CN |
| InChI | InChI=1S/C60H114N4O2/c1-4-7-10-13-16-19-22-25-28-31-34-37-40-43-47-58(54-59(65)55-61)48-53-63(49-44-41-38-35-32-29-26-23-20-17-14-11-8-5-2)51-46-52-64(57-60(66)56-62)50-45-42-39-36-33-30-27-24-21-18-15-12-9-6-3/h16-21,25-30,58-60,65-66H,4-15,22-24,31-57,61-62H2,1-3H3/b19-16?,20-17?,21-18-,28-25-,29-26-,30-27? |
| InChIKey | BEMXLXRETSSXCP-ZAURYQSXSA-N |
| XLogP | 15.51 |
| TPSA | 98.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 52 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 923.60 |
| LogP ≤ 5 | 15.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|