C43H80N4O2 — CID 161346936
1-amino-3-[[(3-amino-2-hydroxypropyl)-[(9Z,12Z,15Z)-octadeca-9,12,15-trien-8-yl]amino]methyl-[(9E,12Z,15Z)-octadeca-9,12,15-trienyl]amino]propan-2-ol (PubChem CID 161346936) has the molecular formula C43H80N4O2 and a molecular weight of 685.14 g/mol. Its IUPAC name is 1-amino-3-[[(3-amino-2-hydroxypropyl)-[(9Z,12Z,15Z)-octadeca-9,12,15-trien-8-yl]amino]methyl-[(9E,12Z,15Z)-octadeca-9,12,15-trienyl]amino]propan-2-ol.
| Compound Name | 1-amino-3-[[(3-amino-2-hydroxypropyl)-[(9Z,12Z,15Z)-octadeca-9,12,15-trien-8-yl]amino]methyl-[(9E,12Z,15Z)-octadeca-9,12,15-trienyl]amino]propan-2-ol |
|---|---|
| PubChem CID | 161346936 |
| Molecular Formula | C43H80N4O2 |
| Molecular Weight | 685.14 g/mol |
| Exact Mass | 684.63 |
| IUPAC Name | 1-amino-3-[[(3-amino-2-hydroxypropyl)-[(9Z,12Z,15Z)-octadeca-9,12,15-trien-8-yl]amino]methyl-[(9E,12Z,15Z)-octadeca-9,12,15-trienyl]amino]propan-2-ol |
| SMILES | CC/C=C\C/C=C\C/C=C\C(CCCCCCC)N(CC(O)CN)CN(CCCCCCCC/C=C/C/C=C\C/C=C\CC)CC(O)CN |
| InChI | InChI=1S/C43H80N4O2/c1-4-7-10-13-15-17-18-19-20-21-22-23-24-26-29-32-35-46(38-42(48)36-44)40-47(39-43(49)37-45)41(33-30-27-12-9-6-3)34-31-28-25-16-14-11-8-5-2/h7-8,10-11,15-17,19-20,25,31,34,41-43,48-49H,4-6,9,12-14,18,21-24,26-30,32-33,35-40,44-45H2,1-3H3/b10-7-,11-8-,17-15-,20-19+,25-16-,34-31- |
| InChIKey | VNKVHKPNRHROMA-TUIIXLEXSA-N |
| XLogP | 9.36 |
| TPSA | 98.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.14 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|