C29H58N4O2 — CID 155762785
1-amino-3-[4-[(3-amino-2-hydroxypropyl)-[(9E,12Z,15Z)-octadeca-9,12,15-trienyl]amino]butyl-methylamino]propan-2-ol (PubChem CID 155762785) has the molecular formula C29H58N4O2 and a molecular weight of 494.81 g/mol. Its IUPAC name is 1-amino-3-[4-[(3-amino-2-hydroxypropyl)-[(9E,12Z,15Z)-octadeca-9,12,15-trienyl]amino]butyl-methylamino]propan-2-ol.
| Compound Name | 1-amino-3-[4-[(3-amino-2-hydroxypropyl)-[(9E,12Z,15Z)-octadeca-9,12,15-trienyl]amino]butyl-methylamino]propan-2-ol |
|---|---|
| PubChem CID | 155762785 |
| Molecular Formula | C29H58N4O2 |
| Molecular Weight | 494.81 g/mol |
| Exact Mass | 494.46 |
| IUPAC Name | 1-amino-3-[4-[(3-amino-2-hydroxypropyl)-[(9E,12Z,15Z)-octadeca-9,12,15-trienyl]amino]butyl-methylamino]propan-2-ol |
| SMILES | CC/C=C\C/C=C\C/C=C/CCCCCCCCN(CCCCN(C)CC(O)CN)CC(O)CN |
| InChI | InChI=1S/C29H58N4O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-22-33(27-29(35)25-31)23-20-19-21-32(2)26-28(34)24-30/h4-5,7-8,10-11,28-29,34-35H,3,6,9,12-27,30-31H2,1-2H3/b5-4-,8-7-,11-10+ |
| InChIKey | HAKCKARXUSXDRF-OZENSHFISA-N |
| XLogP | 4.23 |
| TPSA | 98.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.81 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|